C22H26N2O4S2 — CID 102422359
ethyl 2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propyl]sulfanylcarbothioylamino]acetate (PubChem CID 102422359) has the molecular formula C22H26N2O4S2 and a molecular weight of 446.59 g/mol. Its IUPAC name is ethyl 2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propyl]sulfanylcarbothioylamino]acetate.
| Compound Name | ethyl 2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propyl]sulfanylcarbothioylamino]acetate |
|---|---|
| PubChem CID | 102422359 |
| Molecular Formula | C22H26N2O4S2 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | ethyl 2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propyl]sulfanylcarbothioylamino]acetate |
| SMILES | CCOC(=O)CNC(=S)SC[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H26N2O4S2/c1-2-27-20(25)14-23-22(29)30-16-19(13-17-9-5-3-6-10-17)24-21(26)28-15-18-11-7-4-8-12-18/h3-12,19H,2,13-16H2,1H3,(H,23,29)(H,24,26)/t19-/m0/s1 |
| InChIKey | LRGVVNLVPGXYHO-IBGZPJMESA-N |
| XLogP | 3.69 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|