C17H21NO8 — CID 3059726
diethyl 2-[2-(phenylmethoxycarbonylamino)acetyl]oxypropanedioate (PubChem CID 3059726) has the molecular formula C17H21NO8 and a molecular weight of 367.35 g/mol. Its IUPAC name is diethyl 2-[2-(phenylmethoxycarbonylamino)acetyl]oxypropanedioate.
| Compound Name | diethyl 2-[2-(phenylmethoxycarbonylamino)acetyl]oxypropanedioate |
|---|---|
| PubChem CID | 3059726 |
| Molecular Formula | C17H21NO8 |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | diethyl 2-[2-(phenylmethoxycarbonylamino)acetyl]oxypropanedioate |
| SMILES | CCOC(=O)C(OC(=O)CNC(=O)OCc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C17H21NO8/c1-3-23-15(20)14(16(21)24-4-2)26-13(19)10-18-17(22)25-11-12-8-6-5-7-9-12/h5-9,14H,3-4,10-11H2,1-2H3,(H,18,22) |
| InChIKey | ZUEFZHWKUGNUMX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|