acetamide;2-(phenylmethoxycarbonylamino)acetic acid

C12H16N2O5 — CID 142382396

IUPACacetamide;2-(phenylmethoxycarbonylamino)acetic acid
SMILESCC(N)=O.O=C(O)CNC(=O)OCc1ccccc1
InChIInChI=1S/C10H11NO4.C2H5NO/c12-9(13)6-11-10(14)15-7-8-4-2-1-3-5-8;1-2(3)4/h1-5H,6-7H2,(H,11,14)(H,12,13);1H3,(H2,3,4)
InChIKeyOFEOCWGWVAKURD-UHFFFAOYSA-N
MW268.27 g/mol
LogP0.49
Rot. Bonds4

About acetamide;2-(phenylmethoxycarbonylamino)acetic acid

acetamide;2-(phenylmethoxycarbonylamino)acetic acid (PubChem CID 142382396) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is acetamide;2-(phenylmethoxycarbonylamino)acetic acid.

Molecular Properties

Compound Nameacetamide;2-(phenylmethoxycarbonylamino)acetic acid
PubChem CID142382396
Molecular FormulaC12H16N2O5
Molecular Weight268.27 g/mol
Exact Mass268.11
IUPAC Nameacetamide;2-(phenylmethoxycarbonylamino)acetic acid
SMILESCC(N)=O.O=C(O)CNC(=O)OCc1ccccc1
InChIInChI=1S/C10H11NO4.C2H5NO/c12-9(13)6-11-10(14)15-7-8-4-2-1-3-5-8;1-2(3)4/h1-5H,6-7H2,(H,11,14)(H,12,13);1H3,(H2,3,4)
InChIKeyOFEOCWGWVAKURD-UHFFFAOYSA-N
XLogP0.49
TPSA118.72 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.27
LogP ≤ 50.49
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze acetamide;2-(phenylmethoxycarbonylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetamide;2-(phenylmethoxycarbonylamino)acetic acid?
The IUPAC name of acetamide;2-(phenylmethoxycarbonylamino)acetic acid (CID 142382396) is acetamide;2-(phenylmethoxycarbonylamino)acetic acid.
What is the SMILES notation for acetamide;2-(phenylmethoxycarbonylamino)acetic acid?
The canonical SMILES for acetamide;2-(phenylmethoxycarbonylamino)acetic acid is CC(N)=O.O=C(O)CNC(=O)OCc1ccccc1.
What is the InChIKey of acetamide;2-(phenylmethoxycarbonylamino)acetic acid?
The InChIKey is OFEOCWGWVAKURD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4.C2H5NO/c12-9(13)6-11-10(14)15-7-8-4-2-1-3-5-8;1-2(3)4/h1-5H,6-7H2,(H,11,14)(H,12,13);1H3,(H2,3,4).
What are the key properties of acetamide;2-(phenylmethoxycarbonylamino)acetic acid?
acetamide;2-(phenylmethoxycarbonylamino)acetic acid has a molecular weight of 268.27 g/mol, XLogP of 0.49, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;2-(phenylmethoxycarbonylamino)acetic acid is sourced from PubChem (CID 142382396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).