C12H13NO6 — CID 86217606
2-[(4-acetyloxyphenyl)methoxycarbonylamino]acetic acid (PubChem CID 86217606) has the molecular formula C12H13NO6 and a molecular weight of 267.24 g/mol. Its IUPAC name is 2-[(4-acetyloxyphenyl)methoxycarbonylamino]acetic acid.
| Compound Name | 2-[(4-acetyloxyphenyl)methoxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 86217606 |
| Molecular Formula | C12H13NO6 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2-[(4-acetyloxyphenyl)methoxycarbonylamino]acetic acid |
| SMILES | CC(=O)Oc1ccc(COC(=O)NCC(=O)O)cc1 |
| InChI | InChI=1S/C12H13NO6/c1-8(14)19-10-4-2-9(3-5-10)7-18-12(17)13-6-11(15)16/h2-5H,6-7H2,1H3,(H,13,17)(H,15,16) |
| InChIKey | GYMYPIGBICBJCA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|