C22H23N5O9 — CID 155107269
4-(carboxymethylamino)-3-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methoxycarbonylamino]-4-oxobutanoic acid (PubChem CID 155107269) has the molecular formula C22H23N5O9 and a molecular weight of 501.45 g/mol. Its IUPAC name is 4-(carboxymethylamino)-3-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methoxycarbonylamino]-4-oxobutanoic acid.
| Compound Name | 4-(carboxymethylamino)-3-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methoxycarbonylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 155107269 |
| Molecular Formula | C22H23N5O9 |
| Molecular Weight | 501.45 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 4-(carboxymethylamino)-3-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methoxycarbonylamino]-4-oxobutanoic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc(COC(=O)NC(CC(=O)O)C(=O)NCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C22H23N5O9/c23-21(24)26-14-5-3-13(4-6-14)20(33)36-15-7-1-12(2-8-15)11-35-22(34)27-16(9-17(28)29)19(32)25-10-18(30)31/h1-8,16H,9-11H2,(H,25,32)(H,27,34)(H,28,29)(H,30,31)(H4,23,24,26) |
| InChIKey | CDNCCGBRYIVXQX-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 232.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.45 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|