C17H17N3O3 — CID 144554287
[4-(2-oxopropyl)phenyl] 4-(diaminomethylideneamino)benzoate (PubChem CID 144554287) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is [4-(2-oxopropyl)phenyl] 4-(diaminomethylideneamino)benzoate.
| Compound Name | [4-(2-oxopropyl)phenyl] 4-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 144554287 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | [4-(2-oxopropyl)phenyl] 4-(diaminomethylideneamino)benzoate |
| SMILES | CC(=O)Cc1ccc(OC(=O)c2ccc(N=C(N)N)cc2)cc1 |
| InChI | InChI=1S/C17H17N3O3/c1-11(21)10-12-2-8-15(9-3-12)23-16(22)13-4-6-14(7-5-13)20-17(18)19/h2-9H,10H2,1H3,(H4,18,19,20) |
| InChIKey | LHBRFGMIDZQSQF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|