C18H19N3O4 — CID 23341009
[4-(2-methylpropanoyloxy)phenyl] 4-(diaminomethylideneamino)benzoate (PubChem CID 23341009) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is [4-(2-methylpropanoyloxy)phenyl] 4-(diaminomethylideneamino)benzoate.
| Compound Name | [4-(2-methylpropanoyloxy)phenyl] 4-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 23341009 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | [4-(2-methylpropanoyloxy)phenyl] 4-(diaminomethylideneamino)benzoate |
| SMILES | CC(C)C(=O)Oc1ccc(OC(=O)c2ccc(N=C(N)N)cc2)cc1 |
| InChI | InChI=1S/C18H19N3O4/c1-11(2)16(22)24-14-7-9-15(10-8-14)25-17(23)12-3-5-13(6-4-12)21-18(19)20/h3-11H,1-2H3,(H4,19,20,21) |
| InChIKey | FGRQFNCTELNMII-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|