C15H18N4O7S2 — CID 10342645
methanesulfonic acid;(4-sulfamoylphenyl) 4-(diaminomethylideneamino)benzoate (PubChem CID 10342645) has the molecular formula C15H18N4O7S2 and a molecular weight of 430.46 g/mol. Its IUPAC name is methanesulfonic acid;(4-sulfamoylphenyl) 4-(diaminomethylideneamino)benzoate.
| Compound Name | methanesulfonic acid;(4-sulfamoylphenyl) 4-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 10342645 |
| Molecular Formula | C15H18N4O7S2 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | methanesulfonic acid;(4-sulfamoylphenyl) 4-(diaminomethylideneamino)benzoate |
| SMILES | CS(=O)(=O)O.NC(N)=Nc1ccc(C(=O)Oc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C14H14N4O4S.CH4O3S/c15-14(16)18-10-3-1-9(2-4-10)13(19)22-11-5-7-12(8-6-11)23(17,20)21;1-5(2,3)4/h1-8H,(H4,15,16,18)(H2,17,20,21);1H3,(H,2,3,4) |
| InChIKey | OSILTPUZIFPGFS-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 205.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|