C16H20N4O7S2 — CID 20575431
methanesulfonic acid;[4-(methylsulfamoyl)phenyl] 4-(diaminomethylideneamino)benzoate (PubChem CID 20575431) has the molecular formula C16H20N4O7S2 and a molecular weight of 444.49 g/mol. Its IUPAC name is methanesulfonic acid;[4-(methylsulfamoyl)phenyl] 4-(diaminomethylideneamino)benzoate.
| Compound Name | methanesulfonic acid;[4-(methylsulfamoyl)phenyl] 4-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 20575431 |
| Molecular Formula | C16H20N4O7S2 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | methanesulfonic acid;[4-(methylsulfamoyl)phenyl] 4-(diaminomethylideneamino)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(OC(=O)c2ccc(N=C(N)N)cc2)cc1.CS(=O)(=O)O |
| InChI | InChI=1S/C15H16N4O4S.CH4O3S/c1-18-24(21,22)13-8-6-12(7-9-13)23-14(20)10-2-4-11(5-3-10)19-15(16)17;1-5(2,3)4/h2-9,18H,1H3,(H4,16,17,19);1H3,(H,2,3,4) |
| InChIKey | XPILFDWBEHOPJO-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 191.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|