C22H27N5O3 — CID 10549475
[4-(4-propan-2-ylpiperazine-1-carbonyl)phenyl] 4-(diaminomethylideneamino)benzoate (PubChem CID 10549475) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is [4-(4-propan-2-ylpiperazine-1-carbonyl)phenyl] 4-(diaminomethylideneamino)benzoate.
| Compound Name | [4-(4-propan-2-ylpiperazine-1-carbonyl)phenyl] 4-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 10549475 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | [4-(4-propan-2-ylpiperazine-1-carbonyl)phenyl] 4-(diaminomethylideneamino)benzoate |
| SMILES | CC(C)N1CCN(C(=O)c2ccc(OC(=O)c3ccc(N=C(N)N)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H27N5O3/c1-15(2)26-11-13-27(14-12-26)20(28)16-5-9-19(10-6-16)30-21(29)17-3-7-18(8-4-17)25-22(23)24/h3-10,15H,11-14H2,1-2H3,(H4,23,24,25) |
| InChIKey | KLABHPFICYRWLL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|