C27H34N6O6 — CID 10816229
[4-[2-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-2-oxoethoxy]carbonylphenyl] 4-(diaminomethylideneamino)benzoate (PubChem CID 10816229) has the molecular formula C27H34N6O6 and a molecular weight of 538.61 g/mol. Its IUPAC name is [4-[2-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-2-oxoethoxy]carbonylphenyl] 4-(diaminomethylideneamino)benzoate.
| Compound Name | [4-[2-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-2-oxoethoxy]carbonylphenyl] 4-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 10816229 |
| Molecular Formula | C27H34N6O6 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | [4-[2-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-2-oxoethoxy]carbonylphenyl] 4-(diaminomethylideneamino)benzoate |
| SMILES | CCN(CC)C(=O)CN1CCN(C(=O)COC(=O)c2ccc(OC(=O)c3ccc(N=C(N)N)cc3)cc2)CC1 |
| InChI | InChI=1S/C27H34N6O6/c1-3-32(4-2)23(34)17-31-13-15-33(16-14-31)24(35)18-38-25(36)19-7-11-22(12-8-19)39-26(37)20-5-9-21(10-6-20)30-27(28)29/h5-12H,3-4,13-18H2,1-2H3,(H4,28,29,30) |
| InChIKey | IRHWNXGALLKAPH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 160.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|