C23H26N4O6 — CID 10602745
[4-[3-(2-morpholin-4-yl-2-oxoethoxy)-3-oxopropyl]phenyl] 4-(diaminomethylideneamino)benzoate (PubChem CID 10602745) has the molecular formula C23H26N4O6 and a molecular weight of 454.48 g/mol. Its IUPAC name is [4-[3-(2-morpholin-4-yl-2-oxoethoxy)-3-oxopropyl]phenyl] 4-(diaminomethylideneamino)benzoate.
| Compound Name | [4-[3-(2-morpholin-4-yl-2-oxoethoxy)-3-oxopropyl]phenyl] 4-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 10602745 |
| Molecular Formula | C23H26N4O6 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | [4-[3-(2-morpholin-4-yl-2-oxoethoxy)-3-oxopropyl]phenyl] 4-(diaminomethylideneamino)benzoate |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc(CCC(=O)OCC(=O)N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C23H26N4O6/c24-23(25)26-18-6-4-17(5-7-18)22(30)33-19-8-1-16(2-9-19)3-10-21(29)32-15-20(28)27-11-13-31-14-12-27/h1-2,4-9H,3,10-15H2,(H4,24,25,26) |
| InChIKey | CRLTVMWWAFLGJW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 146.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|