C22H24N4O5 — CID 90291269
(2R)-1-[3-[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 90291269) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is (2R)-1-[3-[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[3-[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 90291269 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (2R)-1-[3-[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc(CCC(=O)N3CCC[C@@H]3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C22H24N4O5/c23-22(24)25-16-8-6-15(7-9-16)21(30)31-17-10-3-14(4-11-17)5-12-19(27)26-13-1-2-18(26)20(28)29/h3-4,6-11,18H,1-2,5,12-13H2,(H,28,29)(H4,23,24,25)/t18-/m1/s1 |
| InChIKey | MHMUPROGYCZMHS-GOSISDBHSA-N |
| XLogP | 1.82 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|