C21H23N5O4 — CID 175512257
[4-[2-(2-carbamoyl-5-oxopyrrolidin-1-yl)ethyl]phenyl] 4-(diaminomethylideneamino)benzoate (PubChem CID 175512257) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is [4-[2-(2-carbamoyl-5-oxopyrrolidin-1-yl)ethyl]phenyl] 4-(diaminomethylideneamino)benzoate.
| Compound Name | [4-[2-(2-carbamoyl-5-oxopyrrolidin-1-yl)ethyl]phenyl] 4-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 175512257 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | [4-[2-(2-carbamoyl-5-oxopyrrolidin-1-yl)ethyl]phenyl] 4-(diaminomethylideneamino)benzoate |
| SMILES | NC(=O)C1CCC(=O)N1CCc1ccc(OC(=O)c2ccc(N=C(N)N)cc2)cc1 |
| InChI | InChI=1S/C21H23N5O4/c22-19(28)17-9-10-18(27)26(17)12-11-13-1-7-16(8-2-13)30-20(29)14-3-5-15(6-4-14)25-21(23)24/h1-8,17H,9-12H2,(H2,22,28)(H4,23,24,25) |
| InChIKey | YJXKVHLZKIAPEE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 154.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|