C23H18N4O4S — CID 23037498
[4-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]phenyl] 4-(diaminomethylideneamino)benzoate (PubChem CID 23037498) has the molecular formula C23H18N4O4S and a molecular weight of 446.49 g/mol. Its IUPAC name is [4-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]phenyl] 4-(diaminomethylideneamino)benzoate.
| Compound Name | [4-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]phenyl] 4-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 23037498 |
| Molecular Formula | C23H18N4O4S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | [4-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]phenyl] 4-(diaminomethylideneamino)benzoate |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc(SCN3C(=O)c4ccccc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C23H18N4O4S/c24-23(25)26-15-7-5-14(6-8-15)22(30)31-16-9-11-17(12-10-16)32-13-27-20(28)18-3-1-2-4-19(18)21(27)29/h1-12H,13H2,(H4,24,25,26) |
| InChIKey | MGCJNBZQQOOSHF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|