C38H34N10O4 — CID 90435507
(6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate (PubChem CID 90435507) has the molecular formula C38H34N10O4 and a molecular weight of 694.76 g/mol. Its IUPAC name is (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate.
| Compound Name | (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 90435507 |
| Molecular Formula | C38H34N10O4 |
| Molecular Weight | 694.76 g/mol |
| Exact Mass | 694.28 |
| IUPAC Name | (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate |
| SMILES | [H]/N=C(\N)c1ccc2cc(OC(=O)c3ccc(N=C(N)N)cc3)ccc2c1.[H]/N=C(\N)c1ccc2cc(OC(=O)c3ccc(N=C(N)N)cc3)ccc2c1 |
| InChI | InChI=1S/2C19H17N5O2/c2*20-17(21)14-2-1-13-10-16(8-5-12(13)9-14)26-18(25)11-3-6-15(7-4-11)24-19(22)23/h2*1-10H,(H3,20,21)(H4,22,23,24) |
| InChIKey | QBIKCQJPRNDNMM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 281.14 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.76 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|