About [6-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate
[6-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate (PubChem CID 10090728) has the molecular formula C21H19N5O2
and a molecular weight of 373.42 g/mol. Its IUPAC name is [6-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate.
Molecular Properties
| Compound Name | [6-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate |
| PubChem CID | 10090728 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | [6-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc3cc(C4=NCCN4)ccc3c2)cc1 |
| InChI | InChI=1S/C21H19N5O2/c22-21(23)26-17-6-3-13(4-7-17)20(27)28-18-8-5-14-11-16(2-1-15(14)12-18)19-24-9-10-25-19/h1-8,11-12H,9-10H2,(H,24,25)(H4,22,23,26) |
| InChIKey | MAPWLFDDCMNFPI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [6-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate?
The IUPAC name of [6-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate (CID 10090728) is [6-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate.
What is the SMILES notation for [6-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate?
The canonical SMILES for [6-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate is NC(N)=Nc1ccc(C(=O)Oc2ccc3cc(C4=NCCN4)ccc3c2)cc1.
What is the InChIKey of [6-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate?
The InChIKey is MAPWLFDDCMNFPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N5O2/c22-21(23)26-17-6-3-13(4-7-17)20(27)28-18-8-5-14-11-16(2-1-15(14)12-18)19-24-9-10-25-19/h1-8,11-12H,9-10H2,(H,24,25)(H4,22,23,26).
What are the key properties of [6-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate?
[6-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate has a molecular weight of 373.42 g/mol, XLogP of 2.31, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate is sourced from PubChem (CID 10090728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).