C21H19N5O2 — CID 10090728
[6-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate (PubChem CID 10090728) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is [6-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate.
| Compound Name | [6-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 10090728 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | [6-(4,5-dihydro-1H-imidazol-2-yl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc3cc(C4=NCCN4)ccc3c2)cc1 |
| InChI | InChI=1S/C21H19N5O2/c22-21(23)26-17-6-3-13(4-7-17)20(27)28-18-8-5-14-11-16(2-1-15(14)12-18)19-24-9-10-25-19/h1-8,11-12H,9-10H2,(H,24,25)(H4,22,23,26) |
| InChIKey | MAPWLFDDCMNFPI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|