C30H26N4O7 — CID 90432775
2-[4-[[carboxymethyl-[6-[4-(diaminomethylideneamino)benzoyl]oxynaphthalene-2-carbonyl]amino]methyl]phenyl]acetic acid (PubChem CID 90432775) has the molecular formula C30H26N4O7 and a molecular weight of 554.56 g/mol. Its IUPAC name is 2-[4-[[carboxymethyl-[6-[4-(diaminomethylideneamino)benzoyl]oxynaphthalene-2-carbonyl]amino]methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[[carboxymethyl-[6-[4-(diaminomethylideneamino)benzoyl]oxynaphthalene-2-carbonyl]amino]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 90432775 |
| Molecular Formula | C30H26N4O7 |
| Molecular Weight | 554.56 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | 2-[4-[[carboxymethyl-[6-[4-(diaminomethylideneamino)benzoyl]oxynaphthalene-2-carbonyl]amino]methyl]phenyl]acetic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc3cc(C(=O)N(CC(=O)O)Cc4ccc(CC(=O)O)cc4)ccc3c2)cc1 |
| InChI | InChI=1S/C30H26N4O7/c31-30(32)33-24-10-7-20(8-11-24)29(40)41-25-12-9-21-14-23(6-5-22(21)15-25)28(39)34(17-27(37)38)16-19-3-1-18(2-4-19)13-26(35)36/h1-12,14-15H,13,16-17H2,(H,35,36)(H,37,38)(H4,31,32,33) |
| InChIKey | ZNFUTOCVDGXZRF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 185.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|