C28H23N5O7S — CID 90432753
2-[4-[[[6-[4-(diaminomethylideneamino)benzoyl]oxy-1-benzothiophene-3-carbonyl]-(2-nitroso-2-oxoethyl)amino]methyl]phenyl]acetic acid (PubChem CID 90432753) has the molecular formula C28H23N5O7S and a molecular weight of 573.59 g/mol. Its IUPAC name is 2-[4-[[[6-[4-(diaminomethylideneamino)benzoyl]oxy-1-benzothiophene-3-carbonyl]-(2-nitroso-2-oxoethyl)amino]methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[[[6-[4-(diaminomethylideneamino)benzoyl]oxy-1-benzothiophene-3-carbonyl]-(2-nitroso-2-oxoethyl)amino]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 90432753 |
| Molecular Formula | C28H23N5O7S |
| Molecular Weight | 573.59 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | 2-[4-[[[6-[4-(diaminomethylideneamino)benzoyl]oxy-1-benzothiophene-3-carbonyl]-(2-nitroso-2-oxoethyl)amino]methyl]phenyl]acetic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc3c(C(=O)N(CC(=O)N=O)Cc4ccc(CC(=O)O)cc4)csc3c2)cc1 |
| InChI | InChI=1S/C28H23N5O7S/c29-28(30)31-19-7-5-18(6-8-19)27(38)40-20-9-10-21-22(15-41-23(21)12-20)26(37)33(14-24(34)32-39)13-17-3-1-16(2-4-17)11-25(35)36/h1-10,12,15H,11,13-14H2,(H,35,36)(H4,29,30,31) |
| InChIKey | TVCQOGWOBHAXHD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 194.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|