C31H31N5O7 — CID 90432245
2-[4-[[[2-[6-[4-(diaminomethylideneamino)benzoyl]oxy-1,2,3,4-tetrahydronaphthalen-1-yl]acetyl]-(2-nitroso-2-oxoethyl)amino]methyl]phenyl]acetic acid (PubChem CID 90432245) has the molecular formula C31H31N5O7 and a molecular weight of 585.62 g/mol. Its IUPAC name is 2-[4-[[[2-[6-[4-(diaminomethylideneamino)benzoyl]oxy-1,2,3,4-tetrahydronaphthalen-1-yl]acetyl]-(2-nitroso-2-oxoethyl)amino]methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[[[2-[6-[4-(diaminomethylideneamino)benzoyl]oxy-1,2,3,4-tetrahydronaphthalen-1-yl]acetyl]-(2-nitroso-2-oxoethyl)amino]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 90432245 |
| Molecular Formula | C31H31N5O7 |
| Molecular Weight | 585.62 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | 2-[4-[[[2-[6-[4-(diaminomethylideneamino)benzoyl]oxy-1,2,3,4-tetrahydronaphthalen-1-yl]acetyl]-(2-nitroso-2-oxoethyl)amino]methyl]phenyl]acetic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc3c(c2)CCCC3CC(=O)N(CC(=O)N=O)Cc2ccc(CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C31H31N5O7/c32-31(33)34-24-10-8-21(9-11-24)30(41)43-25-12-13-26-22(15-25)2-1-3-23(26)16-28(38)36(18-27(37)35-42)17-20-6-4-19(5-7-20)14-29(39)40/h4-13,15,23H,1-3,14,16-18H2,(H,39,40)(H4,32,33,34) |
| InChIKey | OWWPABKPNXJSEW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 194.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.62 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|