C27H26N4O7S — CID 85469852
4-[[carboxymethyl-[(2R)-6-[4-(diaminomethylideneamino)benzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carbonyl]amino]methyl]thiophene-2-carboxylic acid (PubChem CID 85469852) has the molecular formula C27H26N4O7S and a molecular weight of 550.59 g/mol. Its IUPAC name is 4-[[carboxymethyl-[(2R)-6-[4-(diaminomethylideneamino)benzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carbonyl]amino]methyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[[carboxymethyl-[(2R)-6-[4-(diaminomethylideneamino)benzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carbonyl]amino]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 85469852 |
| Molecular Formula | C27H26N4O7S |
| Molecular Weight | 550.59 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | 4-[[carboxymethyl-[(2R)-6-[4-(diaminomethylideneamino)benzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carbonyl]amino]methyl]thiophene-2-carboxylic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc3c(c2)CC[C@@H](C(=O)N(CC(=O)O)Cc2csc(C(=O)O)c2)C3)cc1 |
| InChI | InChI=1S/C27H26N4O7S/c28-27(29)30-20-6-3-16(4-7-20)26(37)38-21-8-5-17-10-19(2-1-18(17)11-21)24(34)31(13-23(32)33)12-15-9-22(25(35)36)39-14-15/h3-9,11,14,19H,1-2,10,12-13H2,(H,32,33)(H,35,36)(H4,28,29,30)/t19-/m1/s1 |
| InChIKey | WBWAXLBPIVCEBK-LJQANCHMSA-N |
| XLogP | 2.79 |
| TPSA | 185.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.59 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|