C26H22Cl2FN5O7S — CID 162305184
4-[[carboxymethyl-[6-[4-(diaminomethylideneamino)-2-fluorobenzoyl]oxyquinoline-2-carbonyl]amino]methyl]thiophene-2-carboxylic acid;dihydrochloride (PubChem CID 162305184) has the molecular formula C26H22Cl2FN5O7S and a molecular weight of 638.46 g/mol. Its IUPAC name is 4-[[carboxymethyl-[6-[4-(diaminomethylideneamino)-2-fluorobenzoyl]oxyquinoline-2-carbonyl]amino]methyl]thiophene-2-carboxylic acid;dihydrochloride.
| Compound Name | 4-[[carboxymethyl-[6-[4-(diaminomethylideneamino)-2-fluorobenzoyl]oxyquinoline-2-carbonyl]amino]methyl]thiophene-2-carboxylic acid;dihydrochloride |
|---|---|
| PubChem CID | 162305184 |
| Molecular Formula | C26H22Cl2FN5O7S |
| Molecular Weight | 638.46 g/mol |
| Exact Mass | 637.06 |
| IUPAC Name | 4-[[carboxymethyl-[6-[4-(diaminomethylideneamino)-2-fluorobenzoyl]oxyquinoline-2-carbonyl]amino]methyl]thiophene-2-carboxylic acid;dihydrochloride |
| SMILES | Cl.Cl.NC(N)=Nc1ccc(C(=O)Oc2ccc3nc(C(=O)N(CC(=O)O)Cc4csc(C(=O)O)c4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C26H20FN5O7S.2ClH/c27-18-9-15(30-26(28)29)2-4-17(18)25(38)39-16-3-6-19-14(8-16)1-5-20(31-19)23(35)32(11-22(33)34)10-13-7-21(24(36)37)40-12-13;;/h1-9,12H,10-11H2,(H,33,34)(H,36,37)(H4,28,29,30);2*1H |
| InChIKey | KZJJJLAZWPTNDQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 198.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|