C26H21N5O7S — CID 71516624
4-[[carboxymethyl-[6-[4-(diaminomethylideneamino)benzoyl]oxyquinoline-2-carbonyl]amino]methyl]thiophene-2-carboxylic acid (PubChem CID 71516624) has the molecular formula C26H21N5O7S and a molecular weight of 547.55 g/mol. Its IUPAC name is 4-[[carboxymethyl-[6-[4-(diaminomethylideneamino)benzoyl]oxyquinoline-2-carbonyl]amino]methyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[[carboxymethyl-[6-[4-(diaminomethylideneamino)benzoyl]oxyquinoline-2-carbonyl]amino]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 71516624 |
| Molecular Formula | C26H21N5O7S |
| Molecular Weight | 547.55 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | 4-[[carboxymethyl-[6-[4-(diaminomethylideneamino)benzoyl]oxyquinoline-2-carbonyl]amino]methyl]thiophene-2-carboxylic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc3nc(C(=O)N(CC(=O)O)Cc4csc(C(=O)O)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C26H21N5O7S/c27-26(28)29-17-4-1-15(2-5-17)25(37)38-18-6-8-19-16(10-18)3-7-20(30-19)23(34)31(12-22(32)33)11-14-9-21(24(35)36)39-13-14/h1-10,13H,11-12H2,(H,32,33)(H,35,36)(H4,27,28,29) |
| InChIKey | DAIBADVQGWIEFB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 198.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|