C27H23N5O7S — CID 71504625
4-[[[(1R)-1-carboxyethyl]-[6-[4-(diaminomethylideneamino)benzoyl]oxyquinoline-2-carbonyl]amino]methyl]thiophene-2-carboxylic acid (PubChem CID 71504625) has the molecular formula C27H23N5O7S and a molecular weight of 561.58 g/mol. Its IUPAC name is 4-[[[(1R)-1-carboxyethyl]-[6-[4-(diaminomethylideneamino)benzoyl]oxyquinoline-2-carbonyl]amino]methyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[[[(1R)-1-carboxyethyl]-[6-[4-(diaminomethylideneamino)benzoyl]oxyquinoline-2-carbonyl]amino]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 71504625 |
| Molecular Formula | C27H23N5O7S |
| Molecular Weight | 561.58 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | 4-[[[(1R)-1-carboxyethyl]-[6-[4-(diaminomethylideneamino)benzoyl]oxyquinoline-2-carbonyl]amino]methyl]thiophene-2-carboxylic acid |
| SMILES | C[C@H](C(=O)O)N(Cc1csc(C(=O)O)c1)C(=O)c1ccc2cc(OC(=O)c3ccc(N=C(N)N)cc3)ccc2n1 |
| InChI | InChI=1S/C27H23N5O7S/c1-14(24(34)35)32(12-15-10-22(25(36)37)40-13-15)23(33)21-8-4-17-11-19(7-9-20(17)31-21)39-26(38)16-2-5-18(6-3-16)30-27(28)29/h2-11,13-14H,12H2,1H3,(H,34,35)(H,36,37)(H4,28,29,30)/t14-/m1/s1 |
| InChIKey | DMQMZHJLQOERFT-CQSZACIVSA-N |
| XLogP | 3.23 |
| TPSA | 198.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.58 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|