C18H19N5O8S — CID 142578920
2-[(carboxymethylsulfamoylamino)methyl]-5-[4-(diaminomethylideneamino)benzoyl]oxybenzoic acid (PubChem CID 142578920) has the molecular formula C18H19N5O8S and a molecular weight of 465.44 g/mol. Its IUPAC name is 2-[(carboxymethylsulfamoylamino)methyl]-5-[4-(diaminomethylideneamino)benzoyl]oxybenzoic acid.
| Compound Name | 2-[(carboxymethylsulfamoylamino)methyl]-5-[4-(diaminomethylideneamino)benzoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 142578920 |
| Molecular Formula | C18H19N5O8S |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 2-[(carboxymethylsulfamoylamino)methyl]-5-[4-(diaminomethylideneamino)benzoyl]oxybenzoic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc(CNS(=O)(=O)NCC(=O)O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C18H19N5O8S/c19-18(20)23-12-4-1-10(2-5-12)17(28)31-13-6-3-11(14(7-13)16(26)27)8-21-32(29,30)22-9-15(24)25/h1-7,21-22H,8-9H2,(H,24,25)(H,26,27)(H4,19,20,23) |
| InChIKey | ZVAFPGUIXFQVDD-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 223.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|