C19H21N5O8S — CID 155093641
2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methylsulfamoylamino]butanedioic acid (PubChem CID 155093641) has the molecular formula C19H21N5O8S and a molecular weight of 479.47 g/mol. Its IUPAC name is 2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methylsulfamoylamino]butanedioic acid.
| Compound Name | 2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methylsulfamoylamino]butanedioic acid |
|---|---|
| PubChem CID | 155093641 |
| Molecular Formula | C19H21N5O8S |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methylsulfamoylamino]butanedioic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc(CNS(=O)(=O)NC(CC(=O)O)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C19H21N5O8S/c20-19(21)23-13-5-3-12(4-6-13)18(29)32-14-7-1-11(2-8-14)10-22-33(30,31)24-15(17(27)28)9-16(25)26/h1-8,15,22,24H,9-10H2,(H,25,26)(H,27,28)(H4,20,21,23) |
| InChIKey | FFNJHKFMTHBNBB-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 223.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|