C20H23N5O8S — CID 142578987
(2S)-2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methylsulfamoyl-methylamino]butanedioic acid (PubChem CID 142578987) has the molecular formula C20H23N5O8S and a molecular weight of 493.50 g/mol. Its IUPAC name is (2S)-2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methylsulfamoyl-methylamino]butanedioic acid.
| Compound Name | (2S)-2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methylsulfamoyl-methylamino]butanedioic acid |
|---|---|
| PubChem CID | 142578987 |
| Molecular Formula | C20H23N5O8S |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | (2S)-2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methylsulfamoyl-methylamino]butanedioic acid |
| SMILES | CN([C@@H](CC(=O)O)C(=O)O)S(=O)(=O)NCc1ccc(OC(=O)c2ccc(N=C(N)N)cc2)cc1 |
| InChI | InChI=1S/C20H23N5O8S/c1-25(16(18(28)29)10-17(26)27)34(31,32)23-11-12-2-8-15(9-3-12)33-19(30)13-4-6-14(7-5-13)24-20(21)22/h2-9,16,23H,10-11H2,1H3,(H,26,27)(H,28,29)(H4,21,22,24)/t16-/m0/s1 |
| InChIKey | DJIYZJFNXRXQJZ-INIZCTEOSA-N |
| XLogP | 0.00 |
| TPSA | 214.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|