C20H20N4O8 — CID 155107273
(2S)-2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenoxy]carbonyl-methylamino]butanedioic acid (PubChem CID 155107273) has the molecular formula C20H20N4O8 and a molecular weight of 444.40 g/mol. Its IUPAC name is (2S)-2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenoxy]carbonyl-methylamino]butanedioic acid.
| Compound Name | (2S)-2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenoxy]carbonyl-methylamino]butanedioic acid |
|---|---|
| PubChem CID | 155107273 |
| Molecular Formula | C20H20N4O8 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | (2S)-2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenoxy]carbonyl-methylamino]butanedioic acid |
| SMILES | CN(C(=O)Oc1ccc(OC(=O)c2ccc(N=C(N)N)cc2)cc1)[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H20N4O8/c1-24(15(17(27)28)10-16(25)26)20(30)32-14-8-6-13(7-9-14)31-18(29)11-2-4-12(5-3-11)23-19(21)22/h2-9,15H,10H2,1H3,(H,25,26)(H,27,28)(H4,21,22,23)/t15-/m0/s1 |
| InChIKey | LFUAUYPFNHFTNX-HNNXBMFYSA-N |
| XLogP | 1.17 |
| TPSA | 194.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|