C27H29N5O8S — CID 155259366
4-[(3S)-3-carboxy-3-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methylsulfamoyl-methylamino]propyl]benzoic acid (PubChem CID 155259366) has the molecular formula C27H29N5O8S and a molecular weight of 583.62 g/mol. Its IUPAC name is 4-[(3S)-3-carboxy-3-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methylsulfamoyl-methylamino]propyl]benzoic acid.
| Compound Name | 4-[(3S)-3-carboxy-3-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methylsulfamoyl-methylamino]propyl]benzoic acid |
|---|---|
| PubChem CID | 155259366 |
| Molecular Formula | C27H29N5O8S |
| Molecular Weight | 583.62 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | 4-[(3S)-3-carboxy-3-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methylsulfamoyl-methylamino]propyl]benzoic acid |
| SMILES | CN([C@@H](CCc1ccc(C(=O)O)cc1)C(=O)O)S(=O)(=O)NCc1ccc(OC(=O)c2ccc(N=C(N)N)cc2)cc1 |
| InChI | InChI=1S/C27H29N5O8S/c1-32(23(25(35)36)15-6-17-2-7-19(8-3-17)24(33)34)41(38,39)30-16-18-4-13-22(14-5-18)40-26(37)20-9-11-21(12-10-20)31-27(28)29/h2-5,7-14,23,30H,6,15-16H2,1H3,(H,33,34)(H,35,36)(H4,28,29,31)/t23-/m0/s1 |
| InChIKey | FGNJTWZFKFOBQY-QHCPKHFHSA-N |
| XLogP | 1.86 |
| TPSA | 214.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.62 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|