C24H25N5O7S — CID 155093693
(2S)-2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methylsulfamoylamino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 155093693) has the molecular formula C24H25N5O7S and a molecular weight of 527.56 g/mol. Its IUPAC name is (2S)-2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methylsulfamoylamino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methylsulfamoylamino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 155093693 |
| Molecular Formula | C24H25N5O7S |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | (2S)-2-[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methylsulfamoylamino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc(CNS(=O)(=O)N[C@@H](Cc3ccc(O)cc3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C24H25N5O7S/c25-24(26)28-18-7-5-17(6-8-18)23(33)36-20-11-3-16(4-12-20)14-27-37(34,35)29-21(22(31)32)13-15-1-9-19(30)10-2-15/h1-12,21,27,29-30H,13-14H2,(H,31,32)(H4,25,26,28)/t21-/m0/s1 |
| InChIKey | CLJISGGEYNVJCD-NRFANRHFSA-N |
| XLogP | 1.14 |
| TPSA | 206.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|