C21H21F4N5O10S — CID 155093747
(2S)-2-[[4-[4-(diaminomethylideneamino)benzoyl]oxy-3-fluorophenyl]methylsulfamoylamino]butanedioic acid;2,2,2-trifluoroacetic acid (PubChem CID 155093747) has the molecular formula C21H21F4N5O10S and a molecular weight of 611.48 g/mol. Its IUPAC name is (2S)-2-[[4-[4-(diaminomethylideneamino)benzoyl]oxy-3-fluorophenyl]methylsulfamoylamino]butanedioic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-[[4-[4-(diaminomethylideneamino)benzoyl]oxy-3-fluorophenyl]methylsulfamoylamino]butanedioic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155093747 |
| Molecular Formula | C21H21F4N5O10S |
| Molecular Weight | 611.48 g/mol |
| Exact Mass | 611.09 |
| IUPAC Name | (2S)-2-[[4-[4-(diaminomethylideneamino)benzoyl]oxy-3-fluorophenyl]methylsulfamoylamino]butanedioic acid;2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc(CNS(=O)(=O)N[C@@H](CC(=O)O)C(=O)O)cc2F)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H20FN5O8S.C2HF3O2/c20-13-7-10(9-23-34(31,32)25-14(17(28)29)8-16(26)27)1-6-15(13)33-18(30)11-2-4-12(5-3-11)24-19(21)22;3-2(4,5)1(6)7/h1-7,14,23,25H,8-9H2,(H,26,27)(H,28,29)(H4,21,22,24);(H,6,7)/t14-;/m0./s1 |
| InChIKey | CUCSCOFZNFKNPA-UQKRIMTDSA-N |
| XLogP | 0.44 |
| TPSA | 260.80 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.48 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|