C22H21F4N3O9S — CID 74983064
(2S)-2-[[3-[4-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]-2-methylpropanoyl]amino]butanedioic acid;2,2,2-trifluoroacetic acid (PubChem CID 74983064) has the molecular formula C22H21F4N3O9S and a molecular weight of 579.48 g/mol. Its IUPAC name is (2S)-2-[[3-[4-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]-2-methylpropanoyl]amino]butanedioic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-[[3-[4-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]-2-methylpropanoyl]amino]butanedioic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 74983064 |
| Molecular Formula | C22H21F4N3O9S |
| Molecular Weight | 579.48 g/mol |
| Exact Mass | 579.09 |
| IUPAC Name | (2S)-2-[[3-[4-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]-2-methylpropanoyl]amino]butanedioic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(OC(=O)c2csc(CC(C)C(=O)N[C@@H](CC(=O)O)C(=O)O)c2)c(F)c1 |
| InChI | InChI=1S/C20H20FN3O7S.C2HF3O2/c1-9(18(27)24-14(19(28)29)7-16(25)26)4-12-5-11(8-32-12)20(30)31-15-3-2-10(17(22)23)6-13(15)21;3-2(4,5)1(6)7/h2-3,5-6,8-9,14H,4,7H2,1H3,(H3,22,23)(H,24,27)(H,25,26)(H,28,29);(H,6,7)/t9?,14-;/m0./s1 |
| InChIKey | WWQGGYLDIJLCLH-PUVHTRCLSA-N |
| XLogP | 2.25 |
| TPSA | 217.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|