C18H16F4N2O7 — CID 74982947
3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylfuran-2-yl]-2-methylpropanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 74982947) has the molecular formula C18H16F4N2O7 and a molecular weight of 448.33 g/mol. Its IUPAC name is 3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylfuran-2-yl]-2-methylpropanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylfuran-2-yl]-2-methylpropanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 74982947 |
| Molecular Formula | C18H16F4N2O7 |
| Molecular Weight | 448.33 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylfuran-2-yl]-2-methylpropanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(OC(=O)c2ccc(CC(C)C(=O)O)o2)c(F)c1 |
| InChI | InChI=1S/C16H15FN2O5.C2HF3O2/c1-8(15(20)21)6-10-3-5-13(23-10)16(22)24-12-4-2-9(14(18)19)7-11(12)17;3-2(4,5)1(6)7/h2-5,7-8H,6H2,1H3,(H3,18,19)(H,20,21);(H,6,7) |
| InChIKey | ZWTRPHFFHBKODA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 163.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|