C21H24N4O7 — CID 74982936
(2S)-5-amino-2-[[(2S)-3-[5-(4-carbamimidoylphenoxy)carbonylfuran-2-yl]-2-methylpropanoyl]amino]-5-oxopentanoic acid (PubChem CID 74982936) has the molecular formula C21H24N4O7 and a molecular weight of 444.44 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(2S)-3-[5-(4-carbamimidoylphenoxy)carbonylfuran-2-yl]-2-methylpropanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[(2S)-3-[5-(4-carbamimidoylphenoxy)carbonylfuran-2-yl]-2-methylpropanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 74982936 |
| Molecular Formula | C21H24N4O7 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (2S)-5-amino-2-[[(2S)-3-[5-(4-carbamimidoylphenoxy)carbonylfuran-2-yl]-2-methylpropanoyl]amino]-5-oxopentanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(C[C@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)O)o2)cc1 |
| InChI | InChI=1S/C21H24N4O7/c1-11(19(27)25-15(20(28)29)7-9-17(22)26)10-14-6-8-16(31-14)21(30)32-13-4-2-12(3-5-13)18(23)24/h2-6,8,11,15H,7,9-10H2,1H3,(H2,22,26)(H3,23,24)(H,25,27)(H,28,29)/t11-,15-/m0/s1 |
| InChIKey | OXVOIWYRXPRXGD-NHYWBVRUSA-N |
| XLogP | 0.80 |
| TPSA | 198.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|