C27H34N4O6 — CID 68563857
(2S)-5-amino-2-[[(E)-3-[3-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]amino]-5-oxopentanoic acid;butane (PubChem CID 68563857) has the molecular formula C27H34N4O6 and a molecular weight of 510.59 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(E)-3-[3-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]amino]-5-oxopentanoic acid;butane.
| Compound Name | (2S)-5-amino-2-[[(E)-3-[3-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]amino]-5-oxopentanoic acid;butane |
|---|---|
| PubChem CID | 68563857 |
| Molecular Formula | C27H34N4O6 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | (2S)-5-amino-2-[[(E)-3-[3-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]amino]-5-oxopentanoic acid;butane |
| SMILES | CCCC.[H]/N=C(\N)c1ccc(OC(=O)c2cccc(/C=C(\C)C(=O)N[C@@H](CCC(N)=O)C(=O)O)c2)cc1 |
| InChI | InChI=1S/C23H24N4O6.C4H10/c1-13(21(29)27-18(22(30)31)9-10-19(24)28)11-14-3-2-4-16(12-14)23(32)33-17-7-5-15(6-8-17)20(25)26;1-3-4-2/h2-8,11-12,18H,9-10H2,1H3,(H2,24,28)(H3,25,26)(H,27,29)(H,30,31);3-4H2,1-2H3/b13-11+;/t18-;/m0./s1 |
| InChIKey | BUWHALYUFUPPLK-XMTGQMICSA-N |
| XLogP | 3.23 |
| TPSA | 185.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|