C28H31N3O7 — CID 70015601
diethyl 2-[[3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]amino]-2-prop-2-enylpropanedioate (PubChem CID 70015601) has the molecular formula C28H31N3O7 and a molecular weight of 521.57 g/mol. Its IUPAC name is diethyl 2-[[3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]amino]-2-prop-2-enylpropanedioate.
| Compound Name | diethyl 2-[[3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]amino]-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 70015601 |
| Molecular Formula | C28H31N3O7 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | diethyl 2-[[3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]amino]-2-prop-2-enylpropanedioate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(C=C(C)C(=O)NC(CC=C)(C(=O)OCC)C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C28H31N3O7/c1-5-16-28(26(34)36-6-2,27(35)37-7-3)31-24(32)18(4)17-19-8-10-21(11-9-19)25(33)38-22-14-12-20(13-15-22)23(29)30/h5,8-15,17H,1,6-7,16H2,2-4H3,(H3,29,30)(H,31,32) |
| InChIKey | ZQSKBXGBKPUXGS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 157.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|