C26H23N3O9 — CID 57279023
[3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]oxycarbonyl-(4-ethoxy-4-oxobut-2-ynyl)carbamic acid (PubChem CID 57279023) has the molecular formula C26H23N3O9 and a molecular weight of 521.48 g/mol. Its IUPAC name is [3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]oxycarbonyl-(4-ethoxy-4-oxobut-2-ynyl)carbamic acid.
| Compound Name | [3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]oxycarbonyl-(4-ethoxy-4-oxobut-2-ynyl)carbamic acid |
|---|---|
| PubChem CID | 57279023 |
| Molecular Formula | C26H23N3O9 |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | [3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]oxycarbonyl-(4-ethoxy-4-oxobut-2-ynyl)carbamic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(C=C(C)C(=O)OC(=O)N(CC#CC(=O)OCC)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C26H23N3O9/c1-3-36-21(30)5-4-14-29(25(33)34)26(35)38-23(31)16(2)15-17-6-8-19(9-7-17)24(32)37-20-12-10-18(11-13-20)22(27)28/h6-13,15H,3,14H2,1-2H3,(H3,27,28)(H,33,34) |
| InChIKey | LSFUPKVDQRSALK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 186.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'} |
|---|