C32H33N3O7 — CID 68564013
(2S)-2-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]-ethylamino]-3-(3-ethoxycarbonylphenyl)propanoic acid (PubChem CID 68564013) has the molecular formula C32H33N3O7 and a molecular weight of 571.63 g/mol. Its IUPAC name is (2S)-2-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]-ethylamino]-3-(3-ethoxycarbonylphenyl)propanoic acid.
| Compound Name | (2S)-2-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]-ethylamino]-3-(3-ethoxycarbonylphenyl)propanoic acid |
|---|---|
| PubChem CID | 68564013 |
| Molecular Formula | C32H33N3O7 |
| Molecular Weight | 571.63 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | (2S)-2-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]-ethylamino]-3-(3-ethoxycarbonylphenyl)propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(/C=C(\C)C(=O)N(CC)[C@@H](Cc3cccc(C(=O)OCC)c3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C32H33N3O7/c1-4-35(27(30(37)38)19-22-7-6-8-25(18-22)31(39)41-5-2)29(36)20(3)17-21-9-11-24(12-10-21)32(40)42-26-15-13-23(14-16-26)28(33)34/h6-18,27H,4-5,19H2,1-3H3,(H3,33,34)(H,37,38)/b20-17+/t27-/m0/s1 |
| InChIKey | XKDWLHIWLNJNMJ-YJRBMFNESA-N |
| XLogP | 4.31 |
| TPSA | 160.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|