C28H33N3O7 — CID 68563656
diethyl 2-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]amino]hexanedioate (PubChem CID 68563656) has the molecular formula C28H33N3O7 and a molecular weight of 523.59 g/mol. Its IUPAC name is diethyl 2-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]amino]hexanedioate.
| Compound Name | diethyl 2-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]amino]hexanedioate |
|---|---|
| PubChem CID | 68563656 |
| Molecular Formula | C28H33N3O7 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | diethyl 2-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]amino]hexanedioate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(/C=C(\C)C(=O)NC(CCCC(=O)OCC)C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C28H33N3O7/c1-4-36-24(32)8-6-7-23(28(35)37-5-2)31-26(33)18(3)17-19-9-11-21(12-10-19)27(34)38-22-15-13-20(14-16-22)25(29)30/h9-17,23H,4-8H2,1-3H3,(H3,29,30)(H,31,33)/b18-17+ |
| InChIKey | KNKOZYGZLFTUSU-ISLYRVAYSA-N |
| XLogP | 3.37 |
| TPSA | 157.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|