C23H27N3O3 — CID 21130037
(4-carbamimidoylphenyl) (E)-2-methyl-3-[4-(pentan-2-ylcarbamoyl)phenyl]prop-2-enoate (PubChem CID 21130037) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is (4-carbamimidoylphenyl) (E)-2-methyl-3-[4-(pentan-2-ylcarbamoyl)phenyl]prop-2-enoate.
| Compound Name | (4-carbamimidoylphenyl) (E)-2-methyl-3-[4-(pentan-2-ylcarbamoyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 21130037 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (4-carbamimidoylphenyl) (E)-2-methyl-3-[4-(pentan-2-ylcarbamoyl)phenyl]prop-2-enoate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)/C(C)=C/c2ccc(C(=O)NC(C)CCC)cc2)cc1 |
| InChI | InChI=1S/C23H27N3O3/c1-4-5-16(3)26-22(27)19-8-6-17(7-9-19)14-15(2)23(28)29-20-12-10-18(11-13-20)21(24)25/h6-14,16H,4-5H2,1-3H3,(H3,24,25)(H,26,27)/b15-14+ |
| InChIKey | UNFUKNZRUWYBGP-CCEZHUSRSA-N |
| XLogP | 3.90 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|