C19H21N3O4 — CID 54024250
2-[4-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]propyl]phenoxy]acetic acid (PubChem CID 54024250) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-[4-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]propyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]propyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 54024250 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-[4-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]propyl]phenoxy]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)N[C@@H](C)Cc2ccc(OCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C19H21N3O4/c1-12(10-13-2-8-16(9-3-13)26-11-17(23)24)22-19(25)15-6-4-14(5-7-15)18(20)21/h2-9,12H,10-11H2,1H3,(H3,20,21)(H,22,25)(H,23,24)/t12-/m0/s1 |
| InChIKey | LBBHPAHYUHZDGQ-LBPRGKRZSA-N |
| XLogP | 1.80 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|