C25H28F3N3O7 — CID 86754677
ethyl 2-[4-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]-3-methylbutanoyl]phenoxy]acetate;2,2,2-trifluoroacetic acid (PubChem CID 86754677) has the molecular formula C25H28F3N3O7 and a molecular weight of 539.51 g/mol. Its IUPAC name is ethyl 2-[4-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]-3-methylbutanoyl]phenoxy]acetate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 2-[4-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]-3-methylbutanoyl]phenoxy]acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86754677 |
| Molecular Formula | C25H28F3N3O7 |
| Molecular Weight | 539.51 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | ethyl 2-[4-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]-3-methylbutanoyl]phenoxy]acetate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(C(=O)N[C@H](C(=O)c2ccc(OCC(=O)OCC)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C23H27N3O5.C2HF3O2/c1-4-30-19(27)13-31-18-11-9-15(10-12-18)21(28)20(14(2)3)26-23(29)17-7-5-16(6-8-17)22(24)25;3-2(4,5)1(6)7/h5-12,14,20H,4,13H2,1-3H3,(H3,24,25)(H,26,29);(H,6,7)/t20-;/m0./s1 |
| InChIKey | XIKBGQBGAFBSNM-BDQAORGHSA-N |
| XLogP | 3.18 |
| TPSA | 168.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|