C31H37F3N2O10 — CID 157126908
butyl 2-[2-(2-butoxy-2-oxoethoxy)-4-[4-(4-carbamimidoylphenyl)-4-oxobutanoyl]phenoxy]acetate;2,2,2-trifluoroacetic acid (PubChem CID 157126908) has the molecular formula C31H37F3N2O10 and a molecular weight of 654.64 g/mol. Its IUPAC name is butyl 2-[2-(2-butoxy-2-oxoethoxy)-4-[4-(4-carbamimidoylphenyl)-4-oxobutanoyl]phenoxy]acetate;2,2,2-trifluoroacetic acid.
| Compound Name | butyl 2-[2-(2-butoxy-2-oxoethoxy)-4-[4-(4-carbamimidoylphenyl)-4-oxobutanoyl]phenoxy]acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 157126908 |
| Molecular Formula | C31H37F3N2O10 |
| Molecular Weight | 654.64 g/mol |
| Exact Mass | 654.24 |
| IUPAC Name | butyl 2-[2-(2-butoxy-2-oxoethoxy)-4-[4-(4-carbamimidoylphenyl)-4-oxobutanoyl]phenoxy]acetate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(C(=O)CCC(=O)c2ccc(OCC(=O)OCCCC)c(OCC(=O)OCCCC)c2)cc1 |
| InChI | InChI=1S/C29H36N2O8.C2HF3O2/c1-3-5-15-36-27(34)18-38-25-14-11-22(17-26(25)39-19-28(35)37-16-6-4-2)24(33)13-12-23(32)20-7-9-21(10-8-20)29(30)31;3-2(4,5)1(6)7/h7-11,14,17H,3-6,12-13,15-16,18-19H2,1-2H3,(H3,30,31);(H,6,7) |
| InChIKey | AIPNMFZRORLHOX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 192.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.64 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|