C12H18N2O — CID 60929965
4-butoxy-3-methylbenzenecarboximidamide (PubChem CID 60929965) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 4-butoxy-3-methylbenzenecarboximidamide.
| Compound Name | 4-butoxy-3-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 60929965 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 4-butoxy-3-methylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCCC)c(C)c1 |
| InChI | InChI=1S/C12H18N2O/c1-3-4-7-15-11-6-5-10(12(13)14)8-9(11)2/h5-6,8H,3-4,7H2,1-2H3,(H3,13,14) |
| InChIKey | NCLGMLIFKIPFPZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|