C14H23N3O — CID 107912552
3-[2-(diethylamino)ethoxy]-4-methylbenzenecarboximidamide (PubChem CID 107912552) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 3-[2-(diethylamino)ethoxy]-4-methylbenzenecarboximidamide.
| Compound Name | 3-[2-(diethylamino)ethoxy]-4-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 107912552 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 3-[2-(diethylamino)ethoxy]-4-methylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C)c(OCCN(CC)CC)c1 |
| InChI | InChI=1S/C14H23N3O/c1-4-17(5-2)8-9-18-13-10-12(14(15)16)7-6-11(13)3/h6-7,10H,4-5,8-9H2,1-3H3,(H3,15,16) |
| InChIKey | WCMCGRHOYOLLCB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|