C11H19N3 — CID 142030148
3,4-dimethylbenzenecarboximidamide;ethanamine (PubChem CID 142030148) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 3,4-dimethylbenzenecarboximidamide;ethanamine.
| Compound Name | 3,4-dimethylbenzenecarboximidamide;ethanamine |
|---|---|
| PubChem CID | 142030148 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 3,4-dimethylbenzenecarboximidamide;ethanamine |
| SMILES | CCN.[H]/N=C(\N)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C9H12N2.C2H7N/c1-6-3-4-8(9(10)11)5-7(6)2;1-2-3/h3-5H,1-2H3,(H3,10,11);2-3H2,1H3 |
| InChIKey | QVMWTDYDMPHCHM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|