C20H28N4O5 — CID 10811208
ethyl 2-[1-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]propanoyl]piperidin-4-yl]oxyacetate (PubChem CID 10811208) has the molecular formula C20H28N4O5 and a molecular weight of 404.47 g/mol. Its IUPAC name is ethyl 2-[1-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]propanoyl]piperidin-4-yl]oxyacetate.
| Compound Name | ethyl 2-[1-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]propanoyl]piperidin-4-yl]oxyacetate |
|---|---|
| PubChem CID | 10811208 |
| Molecular Formula | C20H28N4O5 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | ethyl 2-[1-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]propanoyl]piperidin-4-yl]oxyacetate |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)N[C@@H](C)C(=O)N2CCC(OCC(=O)OCC)CC2)cc1 |
| InChI | InChI=1S/C20H28N4O5/c1-3-28-17(25)12-29-16-8-10-24(11-9-16)20(27)13(2)23-19(26)15-6-4-14(5-7-15)18(21)22/h4-7,13,16H,3,8-12H2,1-2H3,(H3,21,22)(H,23,26)/t13-/m0/s1 |
| InChIKey | UEEVNDRFIJHHGB-ZDUSSCGKSA-N |
| XLogP | 0.66 |
| TPSA | 134.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|