C23H34N4O5 — CID 142640250
tert-butyl 2-[[1-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]propanoyl]piperidin-3-yl]methoxy]acetate (PubChem CID 142640250) has the molecular formula C23H34N4O5 and a molecular weight of 446.55 g/mol. Its IUPAC name is tert-butyl 2-[[1-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]propanoyl]piperidin-3-yl]methoxy]acetate.
| Compound Name | tert-butyl 2-[[1-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]propanoyl]piperidin-3-yl]methoxy]acetate |
|---|---|
| PubChem CID | 142640250 |
| Molecular Formula | C23H34N4O5 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | tert-butyl 2-[[1-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]propanoyl]piperidin-3-yl]methoxy]acetate |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)N[C@@H](C)C(=O)N2CCCC(COCC(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C23H34N4O5/c1-15(26-21(29)18-9-7-17(8-10-18)20(24)25)22(30)27-11-5-6-16(12-27)13-31-14-19(28)32-23(2,3)4/h7-10,15-16H,5-6,11-14H2,1-4H3,(H3,24,25)(H,26,29)/t15-,16?/m0/s1 |
| InChIKey | IJHGHYTUFQEGRR-VYRBHSGPSA-N |
| XLogP | 1.69 |
| TPSA | 134.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|