C24H37N5O4 — CID 174657045
tert-butyl N-[1-[(2S)-2-[(4-carbamimidoylphenyl)methylcarbamoyl]pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 174657045) has the molecular formula C24H37N5O4 and a molecular weight of 459.59 g/mol. Its IUPAC name is tert-butyl N-[1-[(2S)-2-[(4-carbamimidoylphenyl)methylcarbamoyl]pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(2S)-2-[(4-carbamimidoylphenyl)methylcarbamoyl]pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 174657045 |
| Molecular Formula | C24H37N5O4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | tert-butyl N-[1-[(2S)-2-[(4-carbamimidoylphenyl)methylcarbamoyl]pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H]2CCCN2C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H37N5O4/c1-15(2)13-18(28-23(32)33-24(3,4)5)22(31)29-12-6-7-19(29)21(30)27-14-16-8-10-17(11-9-16)20(25)26/h8-11,15,18-19H,6-7,12-14H2,1-5H3,(H3,25,26)(H,27,30)(H,28,32)/t18?,19-/m0/s1 |
| InChIKey | QHKCADDINLATTN-GGYWPGCISA-N |
| XLogP | 2.52 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|