C20H28N4O2 — CID 45139988
(2S)-N-[(4-carbamimidoylphenyl)methyl]-1-(2-cyclopentylacetyl)pyrrolidine-2-carboxamide (PubChem CID 45139988) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is (2S)-N-[(4-carbamimidoylphenyl)methyl]-1-(2-cyclopentylacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-1-(2-cyclopentylacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 45139988 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-1-(2-cyclopentylacetyl)pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H]2CCCN2C(=O)CC2CCCC2)cc1 |
| InChI | InChI=1S/C20H28N4O2/c21-19(22)16-9-7-15(8-10-16)13-23-20(26)17-6-3-11-24(17)18(25)12-14-4-1-2-5-14/h7-10,14,17H,1-6,11-13H2,(H3,21,22)(H,23,26)/t17-/m0/s1 |
| InChIKey | LALPVLXDCXEYDO-KRWDZBQOSA-N |
| XLogP | 2.16 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|